About CID 145059117
CID 145059117 (PubChem CID 145059117) has the molecular formula C23H27N3O4
and a molecular weight of 409.49 g/mol.
Molecular Properties
| Compound Name | CID 145059117 |
| PubChem CID | 145059117 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | — |
| SMILES | COC1CCC2(CC1)Cc1ccc(-c3cncc(C)c3)cc1C21N=C(N)OC1(O)O |
| InChI | InChI=1S/C23H27N3O4/c1-14-9-17(13-25-12-14)15-3-4-16-11-21(7-5-18(29-2)6-8-21)22(19(16)10-15)23(27,28)30-20(24)26-22/h3-4,9-10,12-13,18,27-28H,5-8,11H2,1-2H3,(H2,24,26) |
| InChIKey | MVDPESRYSANBMB-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 110.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze CID 145059117 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 145059117?
The IUPAC name of CID 145059117 (CID 145059117) is not available.
What is the SMILES notation for CID 145059117?
The canonical SMILES for CID 145059117 is COC1CCC2(CC1)Cc1ccc(-c3cncc(C)c3)cc1C21N=C(N)OC1(O)O.
What is the InChIKey of CID 145059117?
The InChIKey is MVDPESRYSANBMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27N3O4/c1-14-9-17(13-25-12-14)15-3-4-16-11-21(7-5-18(29-2)6-8-21)22(19(16)10-15)23(27,28)30-20(24)26-22/h3-4,9-10,12-13,18,27-28H,5-8,11H2,1-2H3,(H2,24,26).
What are the key properties of CID 145059117?
CID 145059117 has a molecular weight of 409.49 g/mol, XLogP of 2.37, 2 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 145059117 is sourced from PubChem (CID 145059117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).