C24H27B2N3O2 — CID 145059157
CID 145059157 (PubChem CID 145059157) has the molecular formula C24H27B2N3O2 and a molecular weight of 411.12 g/mol.
| Compound Name | CID 145059157 |
|---|---|
| PubChem CID | 145059157 |
| Molecular Formula | C24H27B2N3O2 |
| Molecular Weight | 411.12 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | — |
| SMILES | [B]C1([B])OC(N)=NC12c1cc(-c3cncc(C)c3)ccc1C[C@@]21CC[C@H](OC)[C@@H](C)C1 |
| InChI | InChI=1S/C24H27B2N3O2/c1-14-8-18(13-28-12-14)16-4-5-17-11-22(7-6-20(30-3)15(2)10-22)23(19(17)9-16)24(25,26)31-21(27)29-23/h4-5,8-9,12-13,15,20H,6-7,10-11H2,1-3H3,(H2,27,29)/t15-,20-,22-,23?/m0/s1 |
| InChIKey | CLQOTQHZVVUKCQ-HUJXXYTHSA-N |
| XLogP | 2.97 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.12 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|