About CID 140897865
CID 140897865 (PubChem CID 140897865) has the molecular formula C23H27N3O2
and a molecular weight of 379.50 g/mol.
Molecular Properties
| Compound Name | CID 140897865 |
| PubChem CID | 140897865 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.22 |
| IUPAC Name | — |
| SMILES | [2H]C1([2H])OC(N)=N[C@@]12c1cc(-c3ccccn3)ccc1C[C@@]21CC[C@H](OC)[C@@H](C)C1 |
| InChI | InChI=1S/C23H27N3O2/c1-15-12-22(9-8-20(15)27-2)13-17-7-6-16(19-5-3-4-10-25-19)11-18(17)23(22)14-28-21(24)26-23/h3-7,10-11,15,20H,8-9,12-14H2,1-2H3,(H2,24,26)/t15-,20-,22-,23+/m0/s1/i14D2 |
| InChIKey | FFQFADMLDWORMT-MJVQVWTKSA-N |
| XLogP | 3.67 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze CID 140897865 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140897865?
The IUPAC name of CID 140897865 (CID 140897865) is not available.
What is the SMILES notation for CID 140897865?
The canonical SMILES for CID 140897865 is [2H]C1([2H])OC(N)=N[C@@]12c1cc(-c3ccccn3)ccc1C[C@@]21CC[C@H](OC)[C@@H](C)C1.
What is the InChIKey of CID 140897865?
The InChIKey is FFQFADMLDWORMT-MJVQVWTKSA-N. The full InChI is InChI=1S/C23H27N3O2/c1-15-12-22(9-8-20(15)27-2)13-17-7-6-16(19-5-3-4-10-25-19)11-18(17)23(22)14-28-21(24)26-23/h3-7,10-11,15,20H,8-9,12-14H2,1-2H3,(H2,24,26)/t15-,20-,22-,23+/m0/s1/i14D2.
What are the key properties of CID 140897865?
CID 140897865 has a molecular weight of 379.50 g/mol, XLogP of 3.67, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140897865 is sourced from PubChem (CID 140897865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).