C23H27N3O2 — CID 140897865
CID 140897865 (PubChem CID 140897865) has the molecular formula C23H27N3O2 and a molecular weight of 379.50 g/mol.
| Compound Name | CID 140897865 |
|---|---|
| PubChem CID | 140897865 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.22 |
| IUPAC Name | — |
| SMILES | [2H]C1([2H])OC(N)=N[C@@]12c1cc(-c3ccccn3)ccc1C[C@@]21CC[C@H](OC)[C@@H](C)C1 |
| InChI | InChI=1S/C23H27N3O2/c1-15-12-22(9-8-20(15)27-2)13-17-7-6-16(19-5-3-4-10-25-19)11-18(17)23(22)14-28-21(24)26-23/h3-7,10-11,15,20H,8-9,12-14H2,1-2H3,(H2,24,26)/t15-,20-,22-,23+/m0/s1/i14D2 |
| InChIKey | FFQFADMLDWORMT-MJVQVWTKSA-N |
| XLogP | 3.67 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |