C20H22N4O — CID 121276890
CID 121276890 (PubChem CID 121276890) has the molecular formula C20H22N4O and a molecular weight of 334.42 g/mol.
| Compound Name | CID 121276890 |
|---|---|
| PubChem CID | 121276890 |
| Molecular Formula | C20H22N4O |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | — |
| SMILES | NC1=NC2(CO1)c1cc(-c3cccnn3)ccc1CC21CCCCC1 |
| InChI | InChI=1S/C20H22N4O/c21-18-23-20(13-25-18)16-11-14(17-5-4-10-22-24-17)6-7-15(16)12-19(20)8-2-1-3-9-19/h4-7,10-11H,1-3,8-9,12-13H2,(H2,21,23) |
| InChIKey | CPLHYVPIGSXUDP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |