C26H24N6O — CID 58197591
CID 58197591 (PubChem CID 58197591) has the molecular formula C26H24N6O and a molecular weight of 436.52 g/mol.
| Compound Name | CID 58197591 |
|---|---|
| PubChem CID | 58197591 |
| Molecular Formula | C26H24N6O |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | — |
| SMILES | CN1OC2(N=C1N)c1cc(-c3cccc(C#N)c3)ccc1CC21CCCc2cnncc2C1 |
| InChI | InChI=1S/C26H24N6O/c1-32-24(28)31-26(33-32)23-11-19(18-5-2-4-17(10-18)14-27)7-8-20(23)12-25(26)9-3-6-21-15-29-30-16-22(21)13-25/h2,4-5,7-8,10-11,15-16H,3,6,9,12-13H2,1H3,(H2,28,31) |
| InChIKey | FZRKMEJZXFBRKO-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 100.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |