C27H26N4O3 — CID 143944612
3-[(5R)-3-amino-2-methylspiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-6'-yl]benzonitrile;3,4-dihydro-2H-chromene (PubChem CID 143944612) has the molecular formula C27H26N4O3 and a molecular weight of 454.53 g/mol. Its IUPAC name is 3-[(5R)-3-amino-2-methylspiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-6'-yl]benzonitrile;3,4-dihydro-2H-chromene.
| Compound Name | 3-[(5R)-3-amino-2-methylspiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-6'-yl]benzonitrile;3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 143944612 |
| Molecular Formula | C27H26N4O3 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | 3-[(5R)-3-amino-2-methylspiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-6'-yl]benzonitrile;3,4-dihydro-2H-chromene |
| SMILES | CN1O[C@@]2(CCOc3ccc(-c4cccc(C#N)c4)cc32)N=C1N.c1ccc2c(c1)CCCO2 |
| InChI | InChI=1S/C18H16N4O2.C9H10O/c1-22-17(20)21-18(24-22)7-8-23-16-6-5-14(10-15(16)18)13-4-2-3-12(9-13)11-19;1-2-6-9-8(4-1)5-3-7-10-9/h2-6,9-10H,7-8H2,1H3,(H2,20,21);1-2,4,6H,3,5,7H2/t18-;/m1./s1 |
| InChIKey | LOHQMEINMPUDMV-GMUIIQOCSA-N |
| XLogP | 4.36 |
| TPSA | 93.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |