C25H28N4O2 — CID 58423862
CID 58423862 (PubChem CID 58423862) has the molecular formula C25H28N4O2 and a molecular weight of 416.53 g/mol.
| Compound Name | CID 58423862 |
|---|---|
| PubChem CID | 58423862 |
| Molecular Formula | C25H28N4O2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | — |
| SMILES | CC(C)C1CCC2(C1)CC1(N=C(N)N(C)O1)c1cc(-c3cccc(C#N)c3)ccc1O2 |
| InChI | InChI=1S/C25H28N4O2/c1-16(2)20-9-10-24(13-20)15-25(28-23(27)29(3)31-25)21-12-19(7-8-22(21)30-24)18-6-4-5-17(11-18)14-26/h4-8,11-12,16,20H,9-10,13,15H2,1-3H3,(H2,27,28) |
| InChIKey | JPAIGWSFDQLQJI-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 83.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |