C28H30N4O2 — CID 70239648
CID 70239648 (PubChem CID 70239648) has the molecular formula C28H30N4O2 and a molecular weight of 454.57 g/mol.
| Compound Name | CID 70239648 |
|---|---|
| PubChem CID | 70239648 |
| Molecular Formula | C28H30N4O2 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | — |
| SMILES | CN1OC2(CC3(CCCC(c4ccccc4)C3)Oc3ccc(-c4cccc(N)c4)cc32)N=C1N |
| InChI | InChI=1S/C28H30N4O2/c1-32-26(30)31-28(34-32)18-27(14-6-10-22(17-27)19-7-3-2-4-8-19)33-25-13-12-21(16-24(25)28)20-9-5-11-23(29)15-20/h2-5,7-9,11-13,15-16,22H,6,10,14,17-18,29H2,1H3,(H2,30,31) |
| InChIKey | IEHAOWHZEOYABK-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 86.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|