C21H20N4O3 — CID 58424052
CID 58424052 (PubChem CID 58424052) has the molecular formula C21H20N4O3 and a molecular weight of 376.42 g/mol.
| Compound Name | CID 58424052 |
|---|---|
| PubChem CID | 58424052 |
| Molecular Formula | C21H20N4O3 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | — |
| SMILES | [C-]#[N+]c1cccc(-c2ccc3c(c2)C2(CC4(CCOC4)O3)N=C(N)N(C)O2)c1 |
| InChI | InChI=1S/C21H20N4O3/c1-23-16-5-3-4-14(10-16)15-6-7-18-17(11-15)21(24-19(22)25(2)28-21)12-20(27-18)8-9-26-13-20/h3-7,10-11H,8-9,12-13H2,2H3,(H2,22,24) |
| InChIKey | ACJONDIEGYFTGK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 73.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|