C23H22F2N4O3 — CID 58423830
6'-(2,4-difluoro-3-isocyanophenyl)-2-methyl-2'-(oxan-3-yl)spiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-3-amine (PubChem CID 58423830) has the molecular formula C23H22F2N4O3 and a molecular weight of 440.45 g/mol. Its IUPAC name is 6'-(2,4-difluoro-3-isocyanophenyl)-2-methyl-2'-(oxan-3-yl)spiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-3-amine.
| Compound Name | 6'-(2,4-difluoro-3-isocyanophenyl)-2-methyl-2'-(oxan-3-yl)spiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-3-amine |
|---|---|
| PubChem CID | 58423830 |
| Molecular Formula | C23H22F2N4O3 |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 6'-(2,4-difluoro-3-isocyanophenyl)-2-methyl-2'-(oxan-3-yl)spiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-3-amine |
| SMILES | [C-]#[N+]c1c(F)ccc(-c2ccc3c(c2)C2(CC(C4CCCOC4)O3)N=C(N)N(C)O2)c1F |
| InChI | InChI=1S/C23H22F2N4O3/c1-27-21-17(24)7-6-15(20(21)25)13-5-8-18-16(10-13)23(28-22(26)29(2)32-23)11-19(31-18)14-4-3-9-30-12-14/h5-8,10,14,19H,3-4,9,11-12H2,2H3,(H2,26,28) |
| InChIKey | JJAGMFJWNUAWGI-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 73.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|