C22H23F2N3O3 — CID 58423948
(2'R,5S)-6'-(3,5-difluorophenyl)-2-methyl-2'-[(3R)-oxan-3-yl]spiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-3-amine (PubChem CID 58423948) has the molecular formula C22H23F2N3O3 and a molecular weight of 415.44 g/mol. Its IUPAC name is (2'R,5S)-6'-(3,5-difluorophenyl)-2-methyl-2'-[(3R)-oxan-3-yl]spiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-3-amine.
| Compound Name | (2'R,5S)-6'-(3,5-difluorophenyl)-2-methyl-2'-[(3R)-oxan-3-yl]spiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-3-amine |
|---|---|
| PubChem CID | 58423948 |
| Molecular Formula | C22H23F2N3O3 |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | (2'R,5S)-6'-(3,5-difluorophenyl)-2-methyl-2'-[(3R)-oxan-3-yl]spiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-3-amine |
| SMILES | CN1O[C@]2(C[C@H]([C@@H]3CCCOC3)Oc3ccc(-c4cc(F)cc(F)c4)cc32)N=C1N |
| InChI | InChI=1S/C22H23F2N3O3/c1-27-21(25)26-22(30-27)11-20(14-3-2-6-28-12-14)29-19-5-4-13(9-18(19)22)15-7-16(23)10-17(24)8-15/h4-5,7-10,14,20H,2-3,6,11-12H2,1H3,(H2,25,26)/t14-,20-,22+/m1/s1 |
| InChIKey | ZDGABXAMSAKBFL-ZFGLAFRWSA-N |
| XLogP | 3.55 |
| TPSA | 69.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |