C27H30N4O2 — CID 58424077
CID 58424077 (PubChem CID 58424077) has the molecular formula C27H30N4O2 and a molecular weight of 442.56 g/mol.
| Compound Name | CID 58424077 |
|---|---|
| PubChem CID | 58424077 |
| Molecular Formula | C27H30N4O2 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | — |
| SMILES | CN1OC2(C[C@@]3(CCCC4CCCCC43)Oc3ccc(-c4cccc(C#N)c4)cc32)N=C1N |
| InChI | InChI=1S/C27H30N4O2/c1-31-25(29)30-27(33-31)17-26(13-5-9-19-7-2-3-10-22(19)26)32-24-12-11-21(15-23(24)27)20-8-4-6-18(14-20)16-28/h4,6,8,11-12,14-15,19,22H,2-3,5,7,9-10,13,17H2,1H3,(H2,29,30)/t19?,22?,26-,27?/m1/s1 |
| InChIKey | ADQCPPOESAMGSS-NWCZQKGRSA-N |
| XLogP | 5.08 |
| TPSA | 83.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |