C25H28N4O3 — CID 58424713
3-[(2'R,5S)-3-amino-2'-(2,2-dimethyloxan-4-yl)-2-methylspiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-6'-yl]benzonitrile (PubChem CID 58424713) has the molecular formula C25H28N4O3 and a molecular weight of 432.52 g/mol. Its IUPAC name is 3-[(2'R,5S)-3-amino-2'-(2,2-dimethyloxan-4-yl)-2-methylspiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-6'-yl]benzonitrile.
| Compound Name | 3-[(2'R,5S)-3-amino-2'-(2,2-dimethyloxan-4-yl)-2-methylspiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-6'-yl]benzonitrile |
|---|---|
| PubChem CID | 58424713 |
| Molecular Formula | C25H28N4O3 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | 3-[(2'R,5S)-3-amino-2'-(2,2-dimethyloxan-4-yl)-2-methylspiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-6'-yl]benzonitrile |
| SMILES | CN1O[C@]2(C[C@H](C3CCOC(C)(C)C3)Oc3ccc(-c4cccc(C#N)c4)cc32)N=C1N |
| InChI | InChI=1S/C25H28N4O3/c1-24(2)13-19(9-10-30-24)22-14-25(28-23(27)29(3)32-25)20-12-18(7-8-21(20)31-22)17-6-4-5-16(11-17)15-26/h4-8,11-12,19,22H,9-10,13-14H2,1-3H3,(H2,27,28)/t19?,22-,25+/m1/s1 |
| InChIKey | XQDBZHHQKFECMY-NWBNSPHESA-N |
| XLogP | 3.93 |
| TPSA | 93.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |