C27H24N4O3 — CID 58424799
3-[3-amino-2'-(3,4-dihydro-1H-isochromen-4-yl)-2-methylspiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-6'-yl]benzonitrile (PubChem CID 58424799) has the molecular formula C27H24N4O3 and a molecular weight of 452.51 g/mol. Its IUPAC name is 3-[3-amino-2'-(3,4-dihydro-1H-isochromen-4-yl)-2-methylspiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-6'-yl]benzonitrile.
| Compound Name | 3-[3-amino-2'-(3,4-dihydro-1H-isochromen-4-yl)-2-methylspiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-6'-yl]benzonitrile |
|---|---|
| PubChem CID | 58424799 |
| Molecular Formula | C27H24N4O3 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | 3-[3-amino-2'-(3,4-dihydro-1H-isochromen-4-yl)-2-methylspiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-6'-yl]benzonitrile |
| SMILES | CN1OC2(CC(C3COCc4ccccc43)Oc3ccc(-c4cccc(C#N)c4)cc32)N=C1N |
| InChI | InChI=1S/C27H24N4O3/c1-31-26(29)30-27(34-31)13-25(22-16-32-15-20-6-2-3-8-21(20)22)33-24-10-9-19(12-23(24)27)18-7-4-5-17(11-18)14-28/h2-12,22,25H,13,15-16H2,1H3,(H2,29,30) |
| InChIKey | VACCNBOAGFEXIW-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 93.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |