C29H30N4O2 — CID 163893757
2-methyl-6'-[3-[(methylideneamino)methyl]phenyl]-2'-(1,2,3,4-tetrahydronaphthalen-1-yl)spiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-3-amine (PubChem CID 163893757) has the molecular formula C29H30N4O2 and a molecular weight of 466.59 g/mol. Its IUPAC name is 2-methyl-6'-[3-[(methylideneamino)methyl]phenyl]-2'-(1,2,3,4-tetrahydronaphthalen-1-yl)spiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-3-amine.
| Compound Name | 2-methyl-6'-[3-[(methylideneamino)methyl]phenyl]-2'-(1,2,3,4-tetrahydronaphthalen-1-yl)spiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-3-amine |
|---|---|
| PubChem CID | 163893757 |
| Molecular Formula | C29H30N4O2 |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | 2-methyl-6'-[3-[(methylideneamino)methyl]phenyl]-2'-(1,2,3,4-tetrahydronaphthalen-1-yl)spiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-3-amine |
| SMILES | C=NCc1cccc(-c2ccc3c(c2)C2(CC(C4CCCc5ccccc54)O3)N=C(N)N(C)O2)c1 |
| InChI | InChI=1S/C29H30N4O2/c1-31-18-19-7-5-10-21(15-19)22-13-14-26-25(16-22)29(32-28(30)33(2)35-29)17-27(34-26)24-12-6-9-20-8-3-4-11-23(20)24/h3-5,7-8,10-11,13-16,24,27H,1,6,9,12,17-18H2,2H3,(H2,30,32) |
| InChIKey | QDUNNSFWTOJHSH-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|