C29H28N4O2 — CID 58424260
CID 58424260 (PubChem CID 58424260) has the molecular formula C29H28N4O2 and a molecular weight of 464.57 g/mol.
| Compound Name | CID 58424260 |
|---|---|
| PubChem CID | 58424260 |
| Molecular Formula | C29H28N4O2 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | — |
| SMILES | CN1OC2(CC3(CCC(c4ccccc4)CC3)Oc3ccc(-c4cccc(C#N)c4)cc32)N=C1N |
| InChI | InChI=1S/C29H28N4O2/c1-33-27(31)32-29(35-33)19-28(14-12-22(13-15-28)21-7-3-2-4-8-21)34-26-11-10-24(17-25(26)29)23-9-5-6-20(16-23)18-30/h2-11,16-17,22H,12-15,19H2,1H3,(H2,31,32) |
| InChIKey | KYPPXADEUMVNGM-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 83.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |