C24H24N4O3 — CID 58423809
CID 58423809 (PubChem CID 58423809) has the molecular formula C24H24N4O3 and a molecular weight of 416.48 g/mol.
| Compound Name | CID 58423809 |
|---|---|
| PubChem CID | 58423809 |
| Molecular Formula | C24H24N4O3 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | — |
| SMILES | CN1OC2(CC3(CC4CCC3OC4)Oc3ccc(-c4cccc(C#N)c4)cc32)N=C1N |
| InChI | InChI=1S/C24H24N4O3/c1-28-22(26)27-24(31-28)14-23(11-16-5-8-21(23)29-13-16)30-20-7-6-18(10-19(20)24)17-4-2-3-15(9-17)12-25/h2-4,6-7,9-10,16,21H,5,8,11,13-14H2,1H3,(H2,26,27) |
| InChIKey | MUVMLEABIFOUMG-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 93.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |