C24H25N5O3 — CID 58424673
CID 58424673 (PubChem CID 58424673) has the molecular formula C24H25N5O3 and a molecular weight of 431.50 g/mol.
| Compound Name | CID 58424673 |
|---|---|
| PubChem CID | 58424673 |
| Molecular Formula | C24H25N5O3 |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | — |
| SMILES | CC(=O)N1CCC2(CC1)CC1(N=C(N)N(C)O1)c1cc(-c3cccc(C#N)c3)ccc1O2 |
| InChI | InChI=1S/C24H25N5O3/c1-16(30)29-10-8-23(9-11-29)15-24(27-22(26)28(2)32-24)20-13-19(6-7-21(20)31-23)18-5-3-4-17(12-18)14-25/h3-7,12-13H,8-11,15H2,1-2H3,(H2,26,27) |
| InChIKey | MQQDBVYUYRTTAL-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 104.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |