C25H25N5O3 — CID 46178809
CID 46178809 (PubChem CID 46178809) has the molecular formula C25H25N5O3 and a molecular weight of 443.51 g/mol.
| Compound Name | CID 46178809 |
|---|---|
| PubChem CID | 46178809 |
| Molecular Formula | C25H25N5O3 |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | — |
| SMILES | CC(=O)N1CCC2(CC1)CC1(N=C(N)N(C)C1=O)c1cc(-c3cccc(C#N)c3)ccc1O2 |
| InChI | InChI=1S/C25H25N5O3/c1-16(31)30-10-8-24(9-11-30)15-25(22(32)29(2)23(27)28-25)20-13-19(6-7-21(20)33-24)18-5-3-4-17(12-18)14-26/h3-7,12-13H,8-11,15H2,1-2H3,(H2,27,28) |
| InChIKey | JXIYNVKSFWBLJD-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 112.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |