C25H23F3N4O2 — CID 58424387
CID 58424387 (PubChem CID 58424387) has the molecular formula C25H23F3N4O2 and a molecular weight of 468.48 g/mol.
| Compound Name | CID 58424387 |
|---|---|
| PubChem CID | 58424387 |
| Molecular Formula | C25H23F3N4O2 |
| Molecular Weight | 468.48 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | — |
| SMILES | CN1C(=O)C2(CC3(CCCC(C(F)(F)F)C3)Oc3ccc(-c4cccc(C#N)c4)cc32)N=C1N |
| InChI | InChI=1S/C25H23F3N4O2/c1-32-21(33)24(31-22(32)30)14-23(9-3-6-18(12-23)25(26,27)28)34-20-8-7-17(11-19(20)24)16-5-2-4-15(10-16)13-29/h2,4-5,7-8,10-11,18H,3,6,9,12,14H2,1H3,(H2,30,31) |
| InChIKey | GUBIANSDKCJVDA-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 91.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.48 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |