C50H48BBrF6N8O6 — CID 160847625
CID 160847625 (PubChem CID 160847625) has the molecular formula C50H48BBrF6N8O6 and a molecular weight of 1061.69 g/mol.
| Compound Name | CID 160847625 |
|---|---|
| PubChem CID | 160847625 |
| Molecular Formula | C50H48BBrF6N8O6 |
| Molecular Weight | 1061.69 g/mol |
| Exact Mass | 1060.29 |
| IUPAC Name | — |
| SMILES | CN1C(=O)C2(CC3(CCCC(C(F)(F)F)C3)Oc3ccc(Br)cc32)N=C1N.[C-]#[N+]c1cccc(-c2ccc3c(c2)C2(CC4(CCCC(C(F)(F)F)C4)O3)N=C(N)N(C)C2=O)c1.[C-]#[N+]c1cccc(B(O)O)c1 |
| InChI | InChI=1S/C25H23F3N4O2.C18H19BrF3N3O2.C7H6BNO2/c1-30-18-7-3-5-15(11-18)16-8-9-20-19(12-16)24(21(33)32(2)22(29)31-24)14-23(34-20)10-4-6-17(13-23)25(26,27)28;1-25-14(26)17(24-15(25)23)9-16(6-2-3-10(8-16)18(20,21)22)27-13-5-4-11(19)7-12(13)17;1-9-7-4-2-3-6(5-7)8(10)11/h3,5,7-9,11-12,17H,4,6,10,13-14H2,2H3,(H2,29,31);4-5,7,10H,2-3,6,8-9H2,1H3,(H2,23,24);2-5,10-11H |
| InChIKey | SIVRFGYNXZXACG-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 185.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1061.69 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|