C24H30N4O3 — CID 91533809
2'-(2,2-dimethyloxan-4-yl)-2-methyl-6'-(6-methyl-2-pyridinyl)spiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-3-amine (PubChem CID 91533809) has the molecular formula C24H30N4O3 and a molecular weight of 422.53 g/mol. Its IUPAC name is 2'-(2,2-dimethyloxan-4-yl)-2-methyl-6'-(6-methyl-2-pyridinyl)spiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-3-amine.
| Compound Name | 2'-(2,2-dimethyloxan-4-yl)-2-methyl-6'-(6-methyl-2-pyridinyl)spiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-3-amine |
|---|---|
| PubChem CID | 91533809 |
| Molecular Formula | C24H30N4O3 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | 2'-(2,2-dimethyloxan-4-yl)-2-methyl-6'-(6-methyl-2-pyridinyl)spiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-3-amine |
| SMILES | Cc1cccc(-c2ccc3c(c2)C2(CC(C4CCOC(C)(C)C4)O3)N=C(N)N(C)O2)n1 |
| InChI | InChI=1S/C24H30N4O3/c1-15-6-5-7-19(26-15)16-8-9-20-18(12-16)24(27-22(25)28(4)31-24)14-21(30-20)17-10-11-29-23(2,3)13-17/h5-9,12,17,21H,10-11,13-14H2,1-4H3,(H2,25,27) |
| InChIKey | YPOUELDYBOZOJB-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 82.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |