C24H28N6O3S — CID 58424826
2'-(2,2-dimethyloxan-4-yl)-6'-(2-imidazol-1-yl-1,3-thiazol-4-yl)-2-methylspiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-3-amine (PubChem CID 58424826) has the molecular formula C24H28N6O3S and a molecular weight of 480.59 g/mol. Its IUPAC name is 2'-(2,2-dimethyloxan-4-yl)-6'-(2-imidazol-1-yl-1,3-thiazol-4-yl)-2-methylspiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-3-amine.
| Compound Name | 2'-(2,2-dimethyloxan-4-yl)-6'-(2-imidazol-1-yl-1,3-thiazol-4-yl)-2-methylspiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-3-amine |
|---|---|
| PubChem CID | 58424826 |
| Molecular Formula | C24H28N6O3S |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | 2'-(2,2-dimethyloxan-4-yl)-6'-(2-imidazol-1-yl-1,3-thiazol-4-yl)-2-methylspiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-3-amine |
| SMILES | CN1OC2(CC(C3CCOC(C)(C)C3)Oc3ccc(-c4csc(-n5ccnc5)n4)cc32)N=C1N |
| InChI | InChI=1S/C24H28N6O3S/c1-23(2)11-16(6-9-31-23)20-12-24(28-21(25)29(3)33-24)17-10-15(4-5-19(17)32-20)18-13-34-22(27-18)30-8-7-26-14-30/h4-5,7-8,10,13-14,16,20H,6,9,11-12H2,1-3H3,(H2,25,28) |
| InChIKey | HMEQKJAVGBOPJL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |