C25H22N4O2 — CID 58423855
7'-(3-isocyanophenyl)-2-methyl-3'-phenylspiro[1,2,4-oxadiazole-5,5'-3,4-dihydro-2H-1-benzoxepine]-3-amine (PubChem CID 58423855) has the molecular formula C25H22N4O2 and a molecular weight of 410.48 g/mol. Its IUPAC name is 7'-(3-isocyanophenyl)-2-methyl-3'-phenylspiro[1,2,4-oxadiazole-5,5'-3,4-dihydro-2H-1-benzoxepine]-3-amine.
| Compound Name | 7'-(3-isocyanophenyl)-2-methyl-3'-phenylspiro[1,2,4-oxadiazole-5,5'-3,4-dihydro-2H-1-benzoxepine]-3-amine |
|---|---|
| PubChem CID | 58423855 |
| Molecular Formula | C25H22N4O2 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 7'-(3-isocyanophenyl)-2-methyl-3'-phenylspiro[1,2,4-oxadiazole-5,5'-3,4-dihydro-2H-1-benzoxepine]-3-amine |
| SMILES | [C-]#[N+]c1cccc(-c2ccc3c(c2)C2(CC(c4ccccc4)CO3)N=C(N)N(C)O2)c1 |
| InChI | InChI=1S/C25H22N4O2/c1-27-21-10-6-9-18(13-21)19-11-12-23-22(14-19)25(28-24(26)29(2)31-25)15-20(16-30-23)17-7-4-3-5-8-17/h3-14,20H,15-16H2,2H3,(H2,26,28) |
| InChIKey | ZRCQMUQKNUSATL-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 64.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|