C25H20N4O2S — CID 58424318
2'-amino-6-(3-isocyanophenyl)-3'-methyl-1-oxo-2-phenylspiro[2,3-dihydrothiochromene-4,5'-imidazole]-4'-one (PubChem CID 58424318) has the molecular formula C25H20N4O2S and a molecular weight of 440.53 g/mol. Its IUPAC name is 2'-amino-6-(3-isocyanophenyl)-3'-methyl-1-oxo-2-phenylspiro[2,3-dihydrothiochromene-4,5'-imidazole]-4'-one.
| Compound Name | 2'-amino-6-(3-isocyanophenyl)-3'-methyl-1-oxo-2-phenylspiro[2,3-dihydrothiochromene-4,5'-imidazole]-4'-one |
|---|---|
| PubChem CID | 58424318 |
| Molecular Formula | C25H20N4O2S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | 2'-amino-6-(3-isocyanophenyl)-3'-methyl-1-oxo-2-phenylspiro[2,3-dihydrothiochromene-4,5'-imidazole]-4'-one |
| SMILES | [C-]#[N+]c1cccc(-c2ccc3c(c2)C2(CC(c4ccccc4)S3=O)N=C(N)N(C)C2=O)c1 |
| InChI | InChI=1S/C25H20N4O2S/c1-27-19-10-6-9-17(13-19)18-11-12-21-20(14-18)25(23(30)29(2)24(26)28-25)15-22(32(21)31)16-7-4-3-5-8-16/h3-14,22H,15H2,2H3,(H2,26,28) |
| InChIKey | LXSAOPXKJOCYEF-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|