C28H24N4O — CID 118592305
CID 118592305 (PubChem CID 118592305) has the molecular formula C28H24N4O and a molecular weight of 432.53 g/mol.
| Compound Name | CID 118592305 |
|---|---|
| PubChem CID | 118592305 |
| Molecular Formula | C28H24N4O |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | — |
| SMILES | CN1OC2(N=C1N)c1cc(-c3cccc(C#N)c3)ccc1CC21C=C[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C28H24N4O/c1-32-26(30)31-28(33-32)25-15-22(21-9-5-6-19(14-21)18-29)10-11-24(25)17-27(28)13-12-23(16-27)20-7-3-2-4-8-20/h2-15,23H,16-17H2,1H3,(H2,30,31)/t23-,27?,28?/m0/s1 |
| InChIKey | JOPWYSAFJDSBLE-GHXQVECXSA-N |
| XLogP | 4.86 |
| TPSA | 74.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|