C23H28N4O2 — CID 140897852
CID 140897852 (PubChem CID 140897852) has the molecular formula C23H28N4O2 and a molecular weight of 394.52 g/mol.
| Compound Name | CID 140897852 |
|---|---|
| PubChem CID | 140897852 |
| Molecular Formula | C23H28N4O2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | — |
| SMILES | [2H]C1([2H])OC(N)=N[C@@]12c1cc(-c3cncnc3C)ccc1C[C@@]21CC[C@H](OC)[C@@H](C)C1 |
| InChI | InChI=1S/C23H28N4O2/c1-14-9-22(7-6-20(14)28-3)10-17-5-4-16(18-11-25-13-26-15(18)2)8-19(17)23(22)12-29-21(24)27-23/h4-5,8,11,13-14,20H,6-7,9-10,12H2,1-3H3,(H2,24,27)/t14-,20-,22-,23+/m0/s1/i12D2 |
| InChIKey | UZYXZILEDYHVHO-NUOLCXHXSA-N |
| XLogP | 3.37 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |