C26H28N4O — CID 139431181
CID 139431181 (PubChem CID 139431181) has the molecular formula C26H28N4O and a molecular weight of 412.54 g/mol.
| Compound Name | CID 139431181 |
|---|---|
| PubChem CID | 139431181 |
| Molecular Formula | C26H28N4O |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | — |
| SMILES | CC#Cc1cncc(-c2ccc3c(c2)[C@@]2(N=CC(N)=N2)[C@@]2(CC[C@@H](OC)C(C)C2)C3)c1 |
| InChI | InChI=1S/C26H28N4O/c1-4-5-18-10-21(15-28-14-18)19-6-7-20-13-25(9-8-23(31-3)17(2)12-25)26(22(20)11-19)29-16-24(27)30-26/h6-7,10-11,14-17,23H,8-9,12-13H2,1-3H3,(H2,27,30)/t17?,23-,25-,26+/m1/s1 |
| InChIKey | AJUIGPKRCPJZGZ-IZDZTDLVSA-N |
| XLogP | 4.09 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|