C28H34N4 — CID 129193955
2-(1,4-dimethylcyclohexyl)-2-[2-ethyl-5-(5-prop-1-ynyl-3-pyridinyl)phenyl]-5-methylimidazol-4-amine (PubChem CID 129193955) has the molecular formula C28H34N4 and a molecular weight of 426.61 g/mol. Its IUPAC name is 2-(1,4-dimethylcyclohexyl)-2-[2-ethyl-5-(5-prop-1-ynyl-3-pyridinyl)phenyl]-5-methylimidazol-4-amine.
| Compound Name | 2-(1,4-dimethylcyclohexyl)-2-[2-ethyl-5-(5-prop-1-ynyl-3-pyridinyl)phenyl]-5-methylimidazol-4-amine |
|---|---|
| PubChem CID | 129193955 |
| Molecular Formula | C28H34N4 |
| Molecular Weight | 426.61 g/mol |
| Exact Mass | 426.28 |
| IUPAC Name | 2-(1,4-dimethylcyclohexyl)-2-[2-ethyl-5-(5-prop-1-ynyl-3-pyridinyl)phenyl]-5-methylimidazol-4-amine |
| SMILES | CC#Cc1cncc(-c2ccc(CC)c(C3(C4(C)CCC(C)CC4)N=C(C)C(N)=N3)c2)c1 |
| InChI | InChI=1S/C28H34N4/c1-6-8-21-15-24(18-30-17-21)23-10-9-22(7-2)25(16-23)28(31-20(4)26(29)32-28)27(5)13-11-19(3)12-14-27/h9-10,15-19H,7,11-14H2,1-5H3,(H2,29,32) |
| InChIKey | UTRIEGJNHFGXJI-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 63.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.61 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|