About CID 118592409
CID 118592409 (PubChem CID 118592409) has the molecular formula C25H25IN4O2
and a molecular weight of 540.41 g/mol.
Molecular Properties
| Compound Name | CID 118592409 |
| PubChem CID | 118592409 |
| Molecular Formula | C25H25IN4O2 |
| Molecular Weight | 540.41 g/mol |
| Exact Mass | 540.10 |
| IUPAC Name | — |
| SMILES | CC#Cc1cncc(-c2ccc3c(c2)C2(N=C(N)N(C)C2=O)C2(CCC(OI)CC2)C3)c1 |
| InChI | InChI=1S/C25H25IN4O2/c1-3-4-16-11-19(15-28-14-16)17-5-6-18-13-24(9-7-20(32-26)8-10-24)25(21(18)12-17)22(31)30(2)23(27)29-25/h5-6,11-12,14-15,20H,7-10,13H2,1-2H3,(H2,27,29) |
| InChIKey | IRGQVUHYLSFXKT-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 80.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 540.41 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 118592409 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 118592409?
The IUPAC name of CID 118592409 (CID 118592409) is not available.
What is the SMILES notation for CID 118592409?
The canonical SMILES for CID 118592409 is CC#Cc1cncc(-c2ccc3c(c2)C2(N=C(N)N(C)C2=O)C2(CCC(OI)CC2)C3)c1.
What is the InChIKey of CID 118592409?
The InChIKey is IRGQVUHYLSFXKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H25IN4O2/c1-3-4-16-11-19(15-28-14-16)17-5-6-18-13-24(9-7-20(32-26)8-10-24)25(21(18)12-17)22(31)30(2)23(27)29-25/h5-6,11-12,14-15,20H,7-10,13H2,1-2H3,(H2,27,29).
What are the key properties of CID 118592409?
CID 118592409 has a molecular weight of 540.41 g/mol, XLogP of 3.95, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 118592409 is sourced from PubChem (CID 118592409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).