C25H29NO — CID 130444127
3-(4'-methoxy-3,3-dimethylspiro[1H-indene-2,1'-cyclohexane]-5-yl)-5-prop-1-ynylpyridine (PubChem CID 130444127) has the molecular formula C25H29NO and a molecular weight of 359.51 g/mol. Its IUPAC name is 3-(4'-methoxy-3,3-dimethylspiro[1H-indene-2,1'-cyclohexane]-5-yl)-5-prop-1-ynylpyridine.
| Compound Name | 3-(4'-methoxy-3,3-dimethylspiro[1H-indene-2,1'-cyclohexane]-5-yl)-5-prop-1-ynylpyridine |
|---|---|
| PubChem CID | 130444127 |
| Molecular Formula | C25H29NO |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | 3-(4'-methoxy-3,3-dimethylspiro[1H-indene-2,1'-cyclohexane]-5-yl)-5-prop-1-ynylpyridine |
| SMILES | CC#Cc1cncc(-c2ccc3c(c2)C(C)(C)C2(CCC(OC)CC2)C3)c1 |
| InChI | InChI=1S/C25H29NO/c1-5-6-18-13-21(17-26-16-18)19-7-8-20-15-25(24(2,3)23(20)14-19)11-9-22(27-4)10-12-25/h7-8,13-14,16-17,22H,9-12,15H2,1-4H3 |
| InChIKey | SSTUZWMHARUAIW-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|