C22H24ClN3O4 — CID 145059101
CID 145059101 (PubChem CID 145059101) has the molecular formula C22H24ClN3O4 and a molecular weight of 429.90 g/mol.
| Compound Name | CID 145059101 |
|---|---|
| PubChem CID | 145059101 |
| Molecular Formula | C22H24ClN3O4 |
| Molecular Weight | 429.90 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | — |
| SMILES | COC1CCC2(CC1)Cc1ccc(-c3cncc(Cl)c3)cc1C21N=C(N)OC1(O)O |
| InChI | InChI=1S/C22H24ClN3O4/c1-29-17-4-6-20(7-5-17)10-14-3-2-13(15-8-16(23)12-25-11-15)9-18(14)21(20)22(27,28)30-19(24)26-21/h2-3,8-9,11-12,17,27-28H,4-7,10H2,1H3,(H2,24,26) |
| InChIKey | IUZRYOAFNHODPB-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 110.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.90 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|