C26H29N3O2 — CID 140897845
CID 140897845 (PubChem CID 140897845) has the molecular formula C26H29N3O2 and a molecular weight of 417.55 g/mol.
| Compound Name | CID 140897845 |
|---|---|
| PubChem CID | 140897845 |
| Molecular Formula | C26H29N3O2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | — |
| SMILES | [2H]C1([2H])OC(N)=N[C@@]12c1cc(-c3cncc(C#CC)c3)ccc1C[C@@]21CC[C@H](OC)[C@@H](C)C1 |
| InChI | InChI=1S/C26H29N3O2/c1-4-5-18-10-21(15-28-14-18)19-6-7-20-13-25(9-8-23(30-3)17(2)12-25)26(22(20)11-19)16-31-24(27)29-26/h6-7,10-11,14-15,17,23H,8-9,12-13,16H2,1-3H3,(H2,27,29)/t17-,23-,25-,26+/m0/s1/i16D2 |
| InChIKey | BXSKVXJDUDYCJA-NEUOACBISA-N |
| XLogP | 4.04 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|