About CID 174011226
CID 174011226 (PubChem CID 174011226) has the molecular formula C26H28N4
and a molecular weight of 396.54 g/mol.
Molecular Properties
| Compound Name | CID 174011226 |
| PubChem CID | 174011226 |
| Molecular Formula | C26H28N4 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | — |
| SMILES | CC#Cc1cncc(-c2ccc3c(c2)[C@@]2(N=C(C)C(N)=N2)C2(CCCCC2)[C@H]3C)c1 |
| InChI | InChI=1S/C26H28N4/c1-4-8-19-13-21(16-28-15-19)20-9-10-22-17(2)25(11-6-5-7-12-25)26(23(22)14-20)29-18(3)24(27)30-26/h9-10,13-17H,5-7,11-12H2,1-3H3,(H2,27,30)/t17-,26-/m0/s1 |
| InChIKey | OEEJMCGJBPIUKZ-QLXKLKPCSA-N |
| XLogP | 5.17 |
| TPSA | 63.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 174011226 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174011226?
The IUPAC name of CID 174011226 (CID 174011226) is not available.
What is the SMILES notation for CID 174011226?
The canonical SMILES for CID 174011226 is CC#Cc1cncc(-c2ccc3c(c2)[C@@]2(N=C(C)C(N)=N2)C2(CCCCC2)[C@H]3C)c1.
What is the InChIKey of CID 174011226?
The InChIKey is OEEJMCGJBPIUKZ-QLXKLKPCSA-N. The full InChI is InChI=1S/C26H28N4/c1-4-8-19-13-21(16-28-15-19)20-9-10-22-17(2)25(11-6-5-7-12-25)26(23(22)14-20)29-18(3)24(27)30-26/h9-10,13-17H,5-7,11-12H2,1-3H3,(H2,27,30)/t17-,26-/m0/s1.
What are the key properties of CID 174011226?
CID 174011226 has a molecular weight of 396.54 g/mol, XLogP of 5.17, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174011226 is sourced from PubChem (CID 174011226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).