C26H28N4 — CID 174011226
CID 174011226 (PubChem CID 174011226) has the molecular formula C26H28N4 and a molecular weight of 396.54 g/mol.
| Compound Name | CID 174011226 |
|---|---|
| PubChem CID | 174011226 |
| Molecular Formula | C26H28N4 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | — |
| SMILES | CC#Cc1cncc(-c2ccc3c(c2)[C@@]2(N=C(C)C(N)=N2)C2(CCCCC2)[C@H]3C)c1 |
| InChI | InChI=1S/C26H28N4/c1-4-8-19-13-21(16-28-15-19)20-9-10-22-17(2)25(11-6-5-7-12-25)26(23(22)14-20)29-18(3)24(27)30-26/h9-10,13-17H,5-7,11-12H2,1-3H3,(H2,27,30)/t17-,26-/m0/s1 |
| InChIKey | OEEJMCGJBPIUKZ-QLXKLKPCSA-N |
| XLogP | 5.17 |
| TPSA | 63.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|