C23H26FN3O2 — CID 140897870
CID 140897870 (PubChem CID 140897870) has the molecular formula C23H26FN3O2 and a molecular weight of 400.51 g/mol.
| Compound Name | CID 140897870 |
|---|---|
| PubChem CID | 140897870 |
| Molecular Formula | C23H26FN3O2 |
| Molecular Weight | 400.51 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])O[C@H]1CC[C@@]2(Cc3ccc(-c4cncc(F)c4)cc3[C@@]23N=C(N)OC3([2H])[2H])C[C@@H]1C |
| InChI | InChI=1S/C23H26FN3O2/c1-14-9-22(6-5-20(14)28-2)10-16-4-3-15(17-7-18(24)12-26-11-17)8-19(16)23(22)13-29-21(25)27-23/h3-4,7-8,11-12,14,20H,5-6,9-10,13H2,1-2H3,(H2,25,27)/t14-,20-,22-,23+/m0/s1/i2D3,13D2 |
| InChIKey | NGMOSAHKOLTNQD-DNXRCKOLSA-N |
| XLogP | 3.81 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.51 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |