C24H30N4O2 — CID 118592457
1-(1-acetyl-4'-methoxy-6-pyridin-3-ylspiro[3H-indene-2,1'-cyclohexane]-1-yl)-2-methylguanidine (PubChem CID 118592457) has the molecular formula C24H30N4O2 and a molecular weight of 406.53 g/mol. Its IUPAC name is 1-(1-acetyl-4'-methoxy-6-pyridin-3-ylspiro[3H-indene-2,1'-cyclohexane]-1-yl)-2-methylguanidine.
| Compound Name | 1-(1-acetyl-4'-methoxy-6-pyridin-3-ylspiro[3H-indene-2,1'-cyclohexane]-1-yl)-2-methylguanidine |
|---|---|
| PubChem CID | 118592457 |
| Molecular Formula | C24H30N4O2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | 1-(1-acetyl-4'-methoxy-6-pyridin-3-ylspiro[3H-indene-2,1'-cyclohexane]-1-yl)-2-methylguanidine |
| SMILES | C/N=C(\N)NC1(C(C)=O)c2cc(-c3cccnc3)ccc2CC12CCC(OC)CC2 |
| InChI | InChI=1S/C24H30N4O2/c1-16(29)24(28-22(25)26-2)21-13-17(19-5-4-12-27-15-19)6-7-18(21)14-23(24)10-8-20(30-3)9-11-23/h4-7,12-13,15,20H,8-11,14H2,1-3H3,(H3,25,26,28) |
| InChIKey | ONRFSNNXKDKDLO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|