C17H23NO3 — CID 10379421
ethyl (4bS,8aR)-4b-(methoxyamino)-6,7,8,9-tetrahydro-5H-fluorene-8a-carboxylate (PubChem CID 10379421) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is ethyl (4bS,8aR)-4b-(methoxyamino)-6,7,8,9-tetrahydro-5H-fluorene-8a-carboxylate.
| Compound Name | ethyl (4bS,8aR)-4b-(methoxyamino)-6,7,8,9-tetrahydro-5H-fluorene-8a-carboxylate |
|---|---|
| PubChem CID | 10379421 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | ethyl (4bS,8aR)-4b-(methoxyamino)-6,7,8,9-tetrahydro-5H-fluorene-8a-carboxylate |
| SMILES | CCOC(=O)[C@@]12CCCC[C@]1(NOC)c1ccccc1C2 |
| InChI | InChI=1S/C17H23NO3/c1-3-21-15(19)16-10-6-7-11-17(16,18-20-2)14-9-5-4-8-13(14)12-16/h4-5,8-9,18H,3,6-7,10-12H2,1-2H3/t16-,17-/m0/s1 |
| InChIKey | NWOOGSKHCJRXDW-IRXDYDNUSA-N |
| XLogP | 2.71 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|