About (1-methylspiro[3,4-dihydronaphthalene-2,1'-cyclohexane]-1-yl) 2-methylpropanoate
(1-methylspiro[3,4-dihydronaphthalene-2,1'-cyclohexane]-1-yl) 2-methylpropanoate (PubChem CID 90246880) has the molecular formula C20H28O2
and a molecular weight of 300.44 g/mol. Its IUPAC name is (1-methylspiro[3,4-dihydronaphthalene-2,1'-cyclohexane]-1-yl) 2-methylpropanoate.
Molecular Properties
| Compound Name | (1-methylspiro[3,4-dihydronaphthalene-2,1'-cyclohexane]-1-yl) 2-methylpropanoate |
| PubChem CID | 90246880 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | (1-methylspiro[3,4-dihydronaphthalene-2,1'-cyclohexane]-1-yl) 2-methylpropanoate |
| SMILES | CC(C)C(=O)OC1(C)c2ccccc2CCC12CCCCC2 |
| InChI | InChI=1S/C20H28O2/c1-15(2)18(21)22-19(3)17-10-6-5-9-16(17)11-14-20(19)12-7-4-8-13-20/h5-6,9-10,15H,4,7-8,11-14H2,1-3H3 |
| InChIKey | YXKOGZSECVIJCE-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1-methylspiro[3,4-dihydronaphthalene-2,1'-cyclohexane]-1-yl) 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylspiro[3,4-dihydronaphthalene-2,1'-cyclohexane]-1-yl) 2-methylpropanoate?
The IUPAC name of (1-methylspiro[3,4-dihydronaphthalene-2,1'-cyclohexane]-1-yl) 2-methylpropanoate (CID 90246880) is (1-methylspiro[3,4-dihydronaphthalene-2,1'-cyclohexane]-1-yl) 2-methylpropanoate.
What is the SMILES notation for (1-methylspiro[3,4-dihydronaphthalene-2,1'-cyclohexane]-1-yl) 2-methylpropanoate?
The canonical SMILES for (1-methylspiro[3,4-dihydronaphthalene-2,1'-cyclohexane]-1-yl) 2-methylpropanoate is CC(C)C(=O)OC1(C)c2ccccc2CCC12CCCCC2.
What is the InChIKey of (1-methylspiro[3,4-dihydronaphthalene-2,1'-cyclohexane]-1-yl) 2-methylpropanoate?
The InChIKey is YXKOGZSECVIJCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28O2/c1-15(2)18(21)22-19(3)17-10-6-5-9-16(17)11-14-20(19)12-7-4-8-13-20/h5-6,9-10,15H,4,7-8,11-14H2,1-3H3.
What are the key properties of (1-methylspiro[3,4-dihydronaphthalene-2,1'-cyclohexane]-1-yl) 2-methylpropanoate?
(1-methylspiro[3,4-dihydronaphthalene-2,1'-cyclohexane]-1-yl) 2-methylpropanoate has a molecular weight of 300.44 g/mol, XLogP of 5.00, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylspiro[3,4-dihydronaphthalene-2,1'-cyclohexane]-1-yl) 2-methylpropanoate is sourced from PubChem (CID 90246880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).