C17H22OS2 — CID 10518764
1-(1,3-dithian-2-yl)spiro[3H-indene-2,1'-cyclopentane]-1-ol (PubChem CID 10518764) has the molecular formula C17H22OS2 and a molecular weight of 306.50 g/mol. Its IUPAC name is 1-(1,3-dithian-2-yl)spiro[3H-indene-2,1'-cyclopentane]-1-ol.
| Compound Name | 1-(1,3-dithian-2-yl)spiro[3H-indene-2,1'-cyclopentane]-1-ol |
|---|---|
| PubChem CID | 10518764 |
| Molecular Formula | C17H22OS2 |
| Molecular Weight | 306.50 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 1-(1,3-dithian-2-yl)spiro[3H-indene-2,1'-cyclopentane]-1-ol |
| SMILES | OC1(C2SCCCS2)c2ccccc2CC12CCCC2 |
| InChI | InChI=1S/C17H22OS2/c18-17(15-19-10-5-11-20-15)14-7-2-1-6-13(14)12-16(17)8-3-4-9-16/h1-2,6-7,15,18H,3-5,8-12H2 |
| InChIKey | NEFPWLCCTWRCFB-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.50 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |