C14H18O2S2 — CID 14843789
1-(1,3-dithian-2-yl)-6-methoxy-2,3-dihydroinden-1-ol (PubChem CID 14843789) has the molecular formula C14H18O2S2 and a molecular weight of 282.43 g/mol. Its IUPAC name is 1-(1,3-dithian-2-yl)-6-methoxy-2,3-dihydroinden-1-ol.
| Compound Name | 1-(1,3-dithian-2-yl)-6-methoxy-2,3-dihydroinden-1-ol |
|---|---|
| PubChem CID | 14843789 |
| Molecular Formula | C14H18O2S2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 1-(1,3-dithian-2-yl)-6-methoxy-2,3-dihydroinden-1-ol |
| SMILES | COc1ccc2c(c1)C(O)(C1SCCCS1)CC2 |
| InChI | InChI=1S/C14H18O2S2/c1-16-11-4-3-10-5-6-14(15,12(10)9-11)13-17-7-2-8-18-13/h3-4,9,13,15H,2,5-8H2,1H3 |
| InChIKey | HRCYHORYXGKISI-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |