C18H22O2 — CID 102249674
1-[2-(1-hydroxycyclohexyl)ethynyl]-3,4-dihydro-2H-naphthalen-1-ol (PubChem CID 102249674) has the molecular formula C18H22O2 and a molecular weight of 270.37 g/mol. Its IUPAC name is 1-[2-(1-hydroxycyclohexyl)ethynyl]-3,4-dihydro-2H-naphthalen-1-ol.
| Compound Name | 1-[2-(1-hydroxycyclohexyl)ethynyl]-3,4-dihydro-2H-naphthalen-1-ol |
|---|---|
| PubChem CID | 102249674 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 1-[2-(1-hydroxycyclohexyl)ethynyl]-3,4-dihydro-2H-naphthalen-1-ol |
| SMILES | OC1(C#CC2(O)CCCc3ccccc32)CCCCC1 |
| InChI | InChI=1S/C18H22O2/c19-17(10-4-1-5-11-17)13-14-18(20)12-6-8-15-7-2-3-9-16(15)18/h2-3,7,9,19-20H,1,4-6,8,10-12H2 |
| InChIKey | KXLVBFQAEDYWDQ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|