C16H20O — CID 164700844
1-hex-1-ynyl-3,4-dihydro-2H-naphthalen-1-ol (PubChem CID 164700844) has the molecular formula C16H20O and a molecular weight of 228.33 g/mol. Its IUPAC name is 1-hex-1-ynyl-3,4-dihydro-2H-naphthalen-1-ol.
| Compound Name | 1-hex-1-ynyl-3,4-dihydro-2H-naphthalen-1-ol |
|---|---|
| PubChem CID | 164700844 |
| Molecular Formula | C16H20O |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 1-hex-1-ynyl-3,4-dihydro-2H-naphthalen-1-ol |
| SMILES | CCCCC#CC1(O)CCCc2ccccc21 |
| InChI | InChI=1S/C16H20O/c1-2-3-4-7-12-16(17)13-8-10-14-9-5-6-11-15(14)16/h5-6,9,11,17H,2-4,8,10,13H2,1H3 |
| InChIKey | OVSHRAONOSJXNH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|