About (1S)-1-hex-1-ynyl-3,4-dihydro-2H-naphthalen-1-ol
(1S)-1-hex-1-ynyl-3,4-dihydro-2H-naphthalen-1-ol (PubChem CID 164700841) has the molecular formula C16H20O
and a molecular weight of 228.33 g/mol. Its IUPAC name is (1S)-1-hex-1-ynyl-3,4-dihydro-2H-naphthalen-1-ol.
Molecular Properties
| Compound Name | (1S)-1-hex-1-ynyl-3,4-dihydro-2H-naphthalen-1-ol |
| PubChem CID | 164700841 |
| Molecular Formula | C16H20O |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | (1S)-1-hex-1-ynyl-3,4-dihydro-2H-naphthalen-1-ol |
| SMILES | CCCCC#C[C@@]1(O)CCCc2ccccc21 |
| InChI | InChI=1S/C16H20O/c1-2-3-4-7-12-16(17)13-8-10-14-9-5-6-11-15(14)16/h5-6,9,11,17H,2-4,8,10,13H2,1H3/t16-/m1/s1 |
| InChIKey | OVSHRAONOSJXNH-MRXNPFEDSA-N |
| XLogP | 3.40 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (1S)-1-hex-1-ynyl-3,4-dihydro-2H-naphthalen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-hex-1-ynyl-3,4-dihydro-2H-naphthalen-1-ol?
The IUPAC name of (1S)-1-hex-1-ynyl-3,4-dihydro-2H-naphthalen-1-ol (CID 164700841) is (1S)-1-hex-1-ynyl-3,4-dihydro-2H-naphthalen-1-ol.
What is the SMILES notation for (1S)-1-hex-1-ynyl-3,4-dihydro-2H-naphthalen-1-ol?
The canonical SMILES for (1S)-1-hex-1-ynyl-3,4-dihydro-2H-naphthalen-1-ol is CCCCC#C[C@@]1(O)CCCc2ccccc21.
What is the InChIKey of (1S)-1-hex-1-ynyl-3,4-dihydro-2H-naphthalen-1-ol?
The InChIKey is OVSHRAONOSJXNH-MRXNPFEDSA-N. The full InChI is InChI=1S/C16H20O/c1-2-3-4-7-12-16(17)13-8-10-14-9-5-6-11-15(14)16/h5-6,9,11,17H,2-4,8,10,13H2,1H3/t16-/m1/s1.
What are the key properties of (1S)-1-hex-1-ynyl-3,4-dihydro-2H-naphthalen-1-ol?
(1S)-1-hex-1-ynyl-3,4-dihydro-2H-naphthalen-1-ol has a molecular weight of 228.33 g/mol, XLogP of 3.40, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-hex-1-ynyl-3,4-dihydro-2H-naphthalen-1-ol is sourced from PubChem (CID 164700841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).