C14H19BrFN3OS — CID 160844847
(3R)-3-(5-amino-4-bromo-2-fluorophenyl)-3,6,6-trimethyl-1-methylidene-1-oxo-2H-1,4-thiazin-5-amine (PubChem CID 160844847) has the molecular formula C14H19BrFN3OS and a molecular weight of 376.30 g/mol. Its IUPAC name is (3R)-3-(5-amino-4-bromo-2-fluorophenyl)-3,6,6-trimethyl-1-methylidene-1-oxo-2H-1,4-thiazin-5-amine.
| Compound Name | (3R)-3-(5-amino-4-bromo-2-fluorophenyl)-3,6,6-trimethyl-1-methylidene-1-oxo-2H-1,4-thiazin-5-amine |
|---|---|
| PubChem CID | 160844847 |
| Molecular Formula | C14H19BrFN3OS |
| Molecular Weight | 376.30 g/mol |
| Exact Mass | 375.04 |
| IUPAC Name | (3R)-3-(5-amino-4-bromo-2-fluorophenyl)-3,6,6-trimethyl-1-methylidene-1-oxo-2H-1,4-thiazin-5-amine |
| SMILES | C=S1(=O)C[C@@](C)(c2cc(N)c(Br)cc2F)N=C(N)C1(C)C |
| InChI | InChI=1S/C14H19BrFN3OS/c1-13(2)12(18)19-14(3,7-21(13,4)20)8-5-11(17)9(15)6-10(8)16/h5-6H,4,7,17H2,1-3H3,(H2,18,19)/t14-,21?/m0/s1 |
| InChIKey | CASOLGUUNWOGLR-YXWRBFHGSA-N |
| XLogP | 2.25 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.30 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|