C12H16FN3O2S — CID 126634136
(2R,5R)-5-(5-amino-2-fluorophenyl)-2,5-dimethyl-1,1-dioxo-2,6-dihydro-1,4-thiazin-3-amine (PubChem CID 126634136) has the molecular formula C12H16FN3O2S and a molecular weight of 285.34 g/mol. Its IUPAC name is (2R,5R)-5-(5-amino-2-fluorophenyl)-2,5-dimethyl-1,1-dioxo-2,6-dihydro-1,4-thiazin-3-amine.
| Compound Name | (2R,5R)-5-(5-amino-2-fluorophenyl)-2,5-dimethyl-1,1-dioxo-2,6-dihydro-1,4-thiazin-3-amine |
|---|---|
| PubChem CID | 126634136 |
| Molecular Formula | C12H16FN3O2S |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | (2R,5R)-5-(5-amino-2-fluorophenyl)-2,5-dimethyl-1,1-dioxo-2,6-dihydro-1,4-thiazin-3-amine |
| SMILES | C[C@@H]1C(N)=N[C@](C)(c2cc(N)ccc2F)CS1(=O)=O |
| InChI | InChI=1S/C12H16FN3O2S/c1-7-11(15)16-12(2,6-19(7,17)18)9-5-8(14)3-4-10(9)13/h3-5,7H,6,14H2,1-2H3,(H2,15,16)/t7-,12+/m1/s1 |
| InChIKey | OWYKRMRBZSGMJQ-KRTXAFLBSA-N |
| XLogP | 0.80 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|