C17H24FN3O3S — CID 123393712
3-(5-amino-2-fluorophenyl)-3,6-dimethyl-6-(oxan-4-yl)-1,1-dioxo-2H-1,4-thiazin-5-amine (PubChem CID 123393712) has the molecular formula C17H24FN3O3S and a molecular weight of 369.46 g/mol. Its IUPAC name is 3-(5-amino-2-fluorophenyl)-3,6-dimethyl-6-(oxan-4-yl)-1,1-dioxo-2H-1,4-thiazin-5-amine.
| Compound Name | 3-(5-amino-2-fluorophenyl)-3,6-dimethyl-6-(oxan-4-yl)-1,1-dioxo-2H-1,4-thiazin-5-amine |
|---|---|
| PubChem CID | 123393712 |
| Molecular Formula | C17H24FN3O3S |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 3-(5-amino-2-fluorophenyl)-3,6-dimethyl-6-(oxan-4-yl)-1,1-dioxo-2H-1,4-thiazin-5-amine |
| SMILES | CC1(c2cc(N)ccc2F)CS(=O)(=O)C(C)(C2CCOCC2)C(N)=N1 |
| InChI | InChI=1S/C17H24FN3O3S/c1-16(13-9-12(19)3-4-14(13)18)10-25(22,23)17(2,15(20)21-16)11-5-7-24-8-6-11/h3-4,9,11H,5-8,10,19H2,1-2H3,(H2,20,21) |
| InChIKey | ZIZKAYFYVRHAAE-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|