C21H26F2N6O4S — CID 123805645
N-[3-(6-amino-2,4,7,7-tetramethyl-1,1-dioxo-3H-1,2,5-thiadiazepin-4-yl)-4-fluorophenyl]-5-(2-fluoroethoxy)pyrazine-2-carboxamide (PubChem CID 123805645) has the molecular formula C21H26F2N6O4S and a molecular weight of 496.54 g/mol. Its IUPAC name is N-[3-(6-amino-2,4,7,7-tetramethyl-1,1-dioxo-3H-1,2,5-thiadiazepin-4-yl)-4-fluorophenyl]-5-(2-fluoroethoxy)pyrazine-2-carboxamide.
| Compound Name | N-[3-(6-amino-2,4,7,7-tetramethyl-1,1-dioxo-3H-1,2,5-thiadiazepin-4-yl)-4-fluorophenyl]-5-(2-fluoroethoxy)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 123805645 |
| Molecular Formula | C21H26F2N6O4S |
| Molecular Weight | 496.54 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | N-[3-(6-amino-2,4,7,7-tetramethyl-1,1-dioxo-3H-1,2,5-thiadiazepin-4-yl)-4-fluorophenyl]-5-(2-fluoroethoxy)pyrazine-2-carboxamide |
| SMILES | CN1CC(C)(c2cc(NC(=O)c3cnc(OCCF)cn3)ccc2F)N=C(N)C(C)(C)S1(=O)=O |
| InChI | InChI=1S/C21H26F2N6O4S/c1-20(2)19(24)28-21(3,12-29(4)34(20,31)32)14-9-13(5-6-15(14)23)27-18(30)16-10-26-17(11-25-16)33-8-7-22/h5-6,9-11H,7-8,12H2,1-4H3,(H2,24,28)(H,27,30) |
| InChIKey | VTHVQJKPWHSZCH-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 139.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.54 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |