C12H10BrFN2O2S — CID 118871896
[4-(5-bromo-2-fluorophenyl)-4-methyl-1,3-thiazin-2-yl]carbamic acid (PubChem CID 118871896) has the molecular formula C12H10BrFN2O2S and a molecular weight of 345.19 g/mol. Its IUPAC name is [4-(5-bromo-2-fluorophenyl)-4-methyl-1,3-thiazin-2-yl]carbamic acid.
| Compound Name | [4-(5-bromo-2-fluorophenyl)-4-methyl-1,3-thiazin-2-yl]carbamic acid |
|---|---|
| PubChem CID | 118871896 |
| Molecular Formula | C12H10BrFN2O2S |
| Molecular Weight | 345.19 g/mol |
| Exact Mass | 343.96 |
| IUPAC Name | [4-(5-bromo-2-fluorophenyl)-4-methyl-1,3-thiazin-2-yl]carbamic acid |
| SMILES | CC1(c2cc(Br)ccc2F)C=CSC(NC(=O)O)=N1 |
| InChI | InChI=1S/C12H10BrFN2O2S/c1-12(8-6-7(13)2-3-9(8)14)4-5-19-10(16-12)15-11(17)18/h2-6H,1H3,(H,15,16)(H,17,18) |
| InChIKey | ZZUDKHRFRMCEIR-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.19 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |