C20H20FN3O2S — CID 58376971
N-[(4S,6Z)-4-(5-amino-2-fluorophenyl)-6-(2-hydroxyethylidene)-4-methyl-5H-1,3-thiazin-2-yl]benzamide (PubChem CID 58376971) has the molecular formula C20H20FN3O2S and a molecular weight of 385.46 g/mol. Its IUPAC name is N-[(4S,6Z)-4-(5-amino-2-fluorophenyl)-6-(2-hydroxyethylidene)-4-methyl-5H-1,3-thiazin-2-yl]benzamide.
| Compound Name | N-[(4S,6Z)-4-(5-amino-2-fluorophenyl)-6-(2-hydroxyethylidene)-4-methyl-5H-1,3-thiazin-2-yl]benzamide |
|---|---|
| PubChem CID | 58376971 |
| Molecular Formula | C20H20FN3O2S |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | N-[(4S,6Z)-4-(5-amino-2-fluorophenyl)-6-(2-hydroxyethylidene)-4-methyl-5H-1,3-thiazin-2-yl]benzamide |
| SMILES | C[C@@]1(c2cc(N)ccc2F)C/C(=C/CO)SC(NC(=O)c2ccccc2)=N1 |
| InChI | InChI=1S/C20H20FN3O2S/c1-20(16-11-14(22)7-8-17(16)21)12-15(9-10-25)27-19(24-20)23-18(26)13-5-3-2-4-6-13/h2-9,11,25H,10,12,22H2,1H3,(H,23,24,26)/b15-9-/t20-/m0/s1 |
| InChIKey | YSOZEWKEVIISIB-WKSDAVQWSA-N |
| XLogP | 3.42 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|