C20H23BrFN5OS — CID 174649182
N-[(4S)-4-(3-bromo-4-fluorophenyl)-4,6,6-tris(methylamino)-5H-1,3-thiazin-2-yl]benzamide (PubChem CID 174649182) has the molecular formula C20H23BrFN5OS and a molecular weight of 480.41 g/mol. Its IUPAC name is N-[(4S)-4-(3-bromo-4-fluorophenyl)-4,6,6-tris(methylamino)-5H-1,3-thiazin-2-yl]benzamide.
| Compound Name | N-[(4S)-4-(3-bromo-4-fluorophenyl)-4,6,6-tris(methylamino)-5H-1,3-thiazin-2-yl]benzamide |
|---|---|
| PubChem CID | 174649182 |
| Molecular Formula | C20H23BrFN5OS |
| Molecular Weight | 480.41 g/mol |
| Exact Mass | 479.08 |
| IUPAC Name | N-[(4S)-4-(3-bromo-4-fluorophenyl)-4,6,6-tris(methylamino)-5H-1,3-thiazin-2-yl]benzamide |
| SMILES | CNC1(NC)C[C@@](NC)(c2ccc(F)c(Br)c2)N=C(NC(=O)c2ccccc2)S1 |
| InChI | InChI=1S/C20H23BrFN5OS/c1-23-19(14-9-10-16(22)15(21)11-14)12-20(24-2,25-3)29-18(27-19)26-17(28)13-7-5-4-6-8-13/h4-11,23-25H,12H2,1-3H3,(H,26,27,28)/t19-/m0/s1 |
| InChIKey | YCLPRJQVOXWEDM-IBGZPJMESA-N |
| XLogP | 2.98 |
| TPSA | 77.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|